About tert-butyl 2-cyclopentylpropanoate
tert-butyl 2-cyclopentylpropanoate (PubChem CID 142496420) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is tert-butyl 2-cyclopentylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 2-cyclopentylpropanoate |
| PubChem CID | 142496420 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | tert-butyl 2-cyclopentylpropanoate |
| SMILES | CC(C(=O)OC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C12H22O2/c1-9(10-7-5-6-8-10)11(13)14-12(2,3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | QZRPJFUHFICUMJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 2-cyclopentylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-cyclopentylpropanoate?
The IUPAC name of tert-butyl 2-cyclopentylpropanoate (CID 142496420) is tert-butyl 2-cyclopentylpropanoate.
What is the SMILES notation for tert-butyl 2-cyclopentylpropanoate?
The canonical SMILES for tert-butyl 2-cyclopentylpropanoate is CC(C(=O)OC(C)(C)C)C1CCCC1.
What is the InChIKey of tert-butyl 2-cyclopentylpropanoate?
The InChIKey is QZRPJFUHFICUMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-9(10-7-5-6-8-10)11(13)14-12(2,3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of tert-butyl 2-cyclopentylpropanoate?
tert-butyl 2-cyclopentylpropanoate has a molecular weight of 198.31 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-cyclopentylpropanoate is sourced from PubChem (CID 142496420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).