2-cyclohexyl-2-hydroxyacetyl chloride

C8H13ClO2 — CID 87847920

IUPAC2-cyclohexyl-2-hydroxyacetyl chloride
SMILESO=C(Cl)C(O)C1CCCCC1
InChIInChI=1S/C8H13ClO2/c9-8(11)7(10)6-4-2-1-3-5-6/h6-7,10H,1-5H2
InChIKeyDJCBICNFOLSBTN-UHFFFAOYSA-N
MW176.64 g/mol
LogP1.69
Rot. Bonds2

About 2-cyclohexyl-2-hydroxyacetyl chloride

2-cyclohexyl-2-hydroxyacetyl chloride (PubChem CID 87847920) has the molecular formula C8H13ClO2 and a molecular weight of 176.64 g/mol. Its IUPAC name is 2-cyclohexyl-2-hydroxyacetyl chloride.

Molecular Properties

Compound Name2-cyclohexyl-2-hydroxyacetyl chloride
PubChem CID87847920
Molecular FormulaC8H13ClO2
Molecular Weight176.64 g/mol
Exact Mass176.06
IUPAC Name2-cyclohexyl-2-hydroxyacetyl chloride
SMILESO=C(Cl)C(O)C1CCCCC1
InChIInChI=1S/C8H13ClO2/c9-8(11)7(10)6-4-2-1-3-5-6/h6-7,10H,1-5H2
InChIKeyDJCBICNFOLSBTN-UHFFFAOYSA-N
XLogP1.69
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.64
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-cyclohexyl-2-hydroxyacetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclohexyl-2-hydroxyacetyl chloride?
The IUPAC name of 2-cyclohexyl-2-hydroxyacetyl chloride (CID 87847920) is 2-cyclohexyl-2-hydroxyacetyl chloride.
What is the SMILES notation for 2-cyclohexyl-2-hydroxyacetyl chloride?
The canonical SMILES for 2-cyclohexyl-2-hydroxyacetyl chloride is O=C(Cl)C(O)C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-2-hydroxyacetyl chloride?
The InChIKey is DJCBICNFOLSBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO2/c9-8(11)7(10)6-4-2-1-3-5-6/h6-7,10H,1-5H2.
What are the key properties of 2-cyclohexyl-2-hydroxyacetyl chloride?
2-cyclohexyl-2-hydroxyacetyl chloride has a molecular weight of 176.64 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-hydroxyacetyl chloride is sourced from PubChem (CID 87847920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).