C11H18O4 — CID 123320630
1-cycloheptyl-1,4-dihydroxybutane-2,3-dione (PubChem CID 123320630) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-cycloheptyl-1,4-dihydroxybutane-2,3-dione.
| Compound Name | 1-cycloheptyl-1,4-dihydroxybutane-2,3-dione |
|---|---|
| PubChem CID | 123320630 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-cycloheptyl-1,4-dihydroxybutane-2,3-dione |
| SMILES | O=C(CO)C(=O)C(O)C1CCCCCC1 |
| InChI | InChI=1S/C11H18O4/c12-7-9(13)11(15)10(14)8-5-3-1-2-4-6-8/h8,10,12,14H,1-7H2 |
| InChIKey | NSIILKHMEJLSBQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|