C19H37FeNO — CID 162289265
cyclopentane;4-cyclopentyl-N,N,2-trimethylhexanamide;iron (PubChem CID 162289265) has the molecular formula C19H37FeNO and a molecular weight of 351.36 g/mol. Its IUPAC name is cyclopentane;4-cyclopentyl-N,N,2-trimethylhexanamide;iron.
| Compound Name | cyclopentane;4-cyclopentyl-N,N,2-trimethylhexanamide;iron |
|---|---|
| PubChem CID | 162289265 |
| Molecular Formula | C19H37FeNO |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | cyclopentane;4-cyclopentyl-N,N,2-trimethylhexanamide;iron |
| SMILES | C1CCCC1.CCC(CC(C)C(=O)N(C)C)C1CCCC1.[Fe] |
| InChI | InChI=1S/C14H27NO.C5H10.Fe/c1-5-12(13-8-6-7-9-13)10-11(2)14(16)15(3)4;1-2-4-5-3-1;/h11-13H,5-10H2,1-4H3;1-5H2; |
| InChIKey | QMPPBUUAGHTOQG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|