C17H30O — CID 145376724
1,3-dicyclohexylpentan-1-one (PubChem CID 145376724) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 1,3-dicyclohexylpentan-1-one.
| Compound Name | 1,3-dicyclohexylpentan-1-one |
|---|---|
| PubChem CID | 145376724 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 1,3-dicyclohexylpentan-1-one |
| SMILES | CCC(CC(=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H30O/c1-2-14(15-9-5-3-6-10-15)13-17(18)16-11-7-4-8-12-16/h14-16H,2-13H2,1H3 |
| InChIKey | GSXOXGHQYVXEHO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |