C24H42O2 — CID 163526339
1-cyclohexylethanone;1,3-dicyclohexylbutan-1-one (PubChem CID 163526339) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is 1-cyclohexylethanone;1,3-dicyclohexylbutan-1-one.
| Compound Name | 1-cyclohexylethanone;1,3-dicyclohexylbutan-1-one |
|---|---|
| PubChem CID | 163526339 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 1-cyclohexylethanone;1,3-dicyclohexylbutan-1-one |
| SMILES | CC(=O)C1CCCCC1.CC(CC(=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H28O.C8H14O/c1-13(14-8-4-2-5-9-14)12-16(17)15-10-6-3-7-11-15;1-7(9)8-5-3-2-4-6-8/h13-15H,2-12H2,1H3;8H,2-6H2,1H3 |
| InChIKey | DPBZRJZODCHNGK-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |