About acetylene;1-cyclohexylethanone;prop-1-yne
acetylene;1-cyclohexylethanone;prop-1-yne (PubChem CID 143179551) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is acetylene;1-cyclohexylethanone;prop-1-yne.
Molecular Properties
| Compound Name | acetylene;1-cyclohexylethanone;prop-1-yne |
| PubChem CID | 143179551 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | acetylene;1-cyclohexylethanone;prop-1-yne |
| SMILES | C#C.C#CC.CC(=O)C1CCCCC1 |
| InChI | InChI=1S/C8H14O.C3H4.C2H2/c1-7(9)8-5-3-2-4-6-8;1-3-2;1-2/h8H,2-6H2,1H3;1H,2H3;1-2H |
| InChIKey | NIMAMLLQZCPBCV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1-cyclohexylethanone;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1-cyclohexylethanone;prop-1-yne?
The IUPAC name of acetylene;1-cyclohexylethanone;prop-1-yne (CID 143179551) is acetylene;1-cyclohexylethanone;prop-1-yne.
What is the SMILES notation for acetylene;1-cyclohexylethanone;prop-1-yne?
The canonical SMILES for acetylene;1-cyclohexylethanone;prop-1-yne is C#C.C#CC.CC(=O)C1CCCCC1.
What is the InChIKey of acetylene;1-cyclohexylethanone;prop-1-yne?
The InChIKey is NIMAMLLQZCPBCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.C3H4.C2H2/c1-7(9)8-5-3-2-4-6-8;1-3-2;1-2/h8H,2-6H2,1H3;1H,2H3;1-2H.
What are the key properties of acetylene;1-cyclohexylethanone;prop-1-yne?
acetylene;1-cyclohexylethanone;prop-1-yne has a molecular weight of 192.30 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1-cyclohexylethanone;prop-1-yne is sourced from PubChem (CID 143179551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).