About 1-cyclopentylethanone;propane
1-cyclopentylethanone;propane (PubChem CID 145026358) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-cyclopentylethanone;propane.
Molecular Properties
| Compound Name | 1-cyclopentylethanone;propane |
| PubChem CID | 145026358 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 1-cyclopentylethanone;propane |
| SMILES | CC(=O)C1CCCC1.CCC |
| InChI | InChI=1S/C7H12O.C3H8/c1-6(8)7-4-2-3-5-7;1-3-2/h7H,2-5H2,1H3;3H2,1-2H3 |
| InChIKey | YOQIEKBLDCTNFQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopentylethanone;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylethanone;propane?
The IUPAC name of 1-cyclopentylethanone;propane (CID 145026358) is 1-cyclopentylethanone;propane.
What is the SMILES notation for 1-cyclopentylethanone;propane?
The canonical SMILES for 1-cyclopentylethanone;propane is CC(=O)C1CCCC1.CCC.
What is the InChIKey of 1-cyclopentylethanone;propane?
The InChIKey is YOQIEKBLDCTNFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C3H8/c1-6(8)7-4-2-3-5-7;1-3-2/h7H,2-5H2,1H3;3H2,1-2H3.
What are the key properties of 1-cyclopentylethanone;propane?
1-cyclopentylethanone;propane has a molecular weight of 156.27 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylethanone;propane is sourced from PubChem (CID 145026358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).