About acetaldehyde;1-cyclohexylethanone;ethane
acetaldehyde;1-cyclohexylethanone;ethane (PubChem CID 145408304) has the molecular formula C14H30O2
and a molecular weight of 230.39 g/mol. Its IUPAC name is acetaldehyde;1-cyclohexylethanone;ethane.
Molecular Properties
| Compound Name | acetaldehyde;1-cyclohexylethanone;ethane |
| PubChem CID | 145408304 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | acetaldehyde;1-cyclohexylethanone;ethane |
| SMILES | CC.CC.CC(=O)C1CCCCC1.CC=O |
| InChI | InChI=1S/C8H14O.C2H4O.2C2H6/c1-7(9)8-5-3-2-4-6-8;1-2-3;2*1-2/h8H,2-6H2,1H3;2H,1H3;2*1-2H3 |
| InChIKey | JVQHXKCPBKEISN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1-cyclohexylethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1-cyclohexylethanone;ethane?
The IUPAC name of acetaldehyde;1-cyclohexylethanone;ethane (CID 145408304) is acetaldehyde;1-cyclohexylethanone;ethane.
What is the SMILES notation for acetaldehyde;1-cyclohexylethanone;ethane?
The canonical SMILES for acetaldehyde;1-cyclohexylethanone;ethane is CC.CC.CC(=O)C1CCCCC1.CC=O.
What is the InChIKey of acetaldehyde;1-cyclohexylethanone;ethane?
The InChIKey is JVQHXKCPBKEISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.C2H4O.2C2H6/c1-7(9)8-5-3-2-4-6-8;1-2-3;2*1-2/h8H,2-6H2,1H3;2H,1H3;2*1-2H3.
What are the key properties of acetaldehyde;1-cyclohexylethanone;ethane?
acetaldehyde;1-cyclohexylethanone;ethane has a molecular weight of 230.39 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1-cyclohexylethanone;ethane is sourced from PubChem (CID 145408304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).