About CID 88741399
CID 88741399 (PubChem CID 88741399) has the molecular formula C8H16O3S2
and a molecular weight of 224.35 g/mol.
Molecular Properties
| Compound Name | CID 88741399 |
| PubChem CID | 88741399 |
| Molecular Formula | C8H16O3S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | — |
| SMILES | CC(=O)C1CCCCC1.SOOS |
| InChI | InChI=1S/C8H14O.H2O2S2/c1-7(9)8-5-3-2-4-6-8;3-1-2-4/h8H,2-6H2,1H3;3-4H |
| InChIKey | PADYOWLNHHRXSP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 88741399 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88741399?
The IUPAC name of CID 88741399 (CID 88741399) is not available.
What is the SMILES notation for CID 88741399?
The canonical SMILES for CID 88741399 is CC(=O)C1CCCCC1.SOOS.
What is the InChIKey of CID 88741399?
The InChIKey is PADYOWLNHHRXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.H2O2S2/c1-7(9)8-5-3-2-4-6-8;3-1-2-4/h8H,2-6H2,1H3;3-4H.
What are the key properties of CID 88741399?
CID 88741399 has a molecular weight of 224.35 g/mol, XLogP of 2.78, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88741399 is sourced from PubChem (CID 88741399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).