C12H22O2 — CID 21325815
acetaldehyde;1-(3,3-dimethylcyclohexyl)ethanone (PubChem CID 21325815) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is acetaldehyde;1-(3,3-dimethylcyclohexyl)ethanone.
| Compound Name | acetaldehyde;1-(3,3-dimethylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 21325815 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | acetaldehyde;1-(3,3-dimethylcyclohexyl)ethanone |
| SMILES | CC(=O)C1CCCC(C)(C)C1.CC=O |
| InChI | InChI=1S/C10H18O.C2H4O/c1-8(11)9-5-4-6-10(2,3)7-9;1-2-3/h9H,4-7H2,1-3H3;2H,1H3 |
| InChIKey | HHCAVSALRMIUKL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|