About 3,3-dimethylcyclohexan-1-amine;formamide
3,3-dimethylcyclohexan-1-amine;formamide (PubChem CID 174943112) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 3,3-dimethylcyclohexan-1-amine;formamide.
Molecular Properties
| Compound Name | 3,3-dimethylcyclohexan-1-amine;formamide |
| PubChem CID | 174943112 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 3,3-dimethylcyclohexan-1-amine;formamide |
| SMILES | CC1(C)CCCC(N)C1.NC=O |
| InChI | InChI=1S/C8H17N.CH3NO/c1-8(2)5-3-4-7(9)6-8;2-1-3/h7H,3-6,9H2,1-2H3;1H,(H2,2,3) |
| InChIKey | ZEGZILBAHZMCOZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylcyclohexan-1-amine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylcyclohexan-1-amine;formamide?
The IUPAC name of 3,3-dimethylcyclohexan-1-amine;formamide (CID 174943112) is 3,3-dimethylcyclohexan-1-amine;formamide.
What is the SMILES notation for 3,3-dimethylcyclohexan-1-amine;formamide?
The canonical SMILES for 3,3-dimethylcyclohexan-1-amine;formamide is CC1(C)CCCC(N)C1.NC=O.
What is the InChIKey of 3,3-dimethylcyclohexan-1-amine;formamide?
The InChIKey is ZEGZILBAHZMCOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.CH3NO/c1-8(2)5-3-4-7(9)6-8;2-1-3/h7H,3-6,9H2,1-2H3;1H,(H2,2,3).
What are the key properties of 3,3-dimethylcyclohexan-1-amine;formamide?
3,3-dimethylcyclohexan-1-amine;formamide has a molecular weight of 172.27 g/mol, XLogP of 1.02, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylcyclohexan-1-amine;formamide is sourced from PubChem (CID 174943112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).