C9H20N2O — CID 174943112
3,3-dimethylcyclohexan-1-amine;formamide (PubChem CID 174943112) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is 3,3-dimethylcyclohexan-1-amine;formamide.
| Compound Name | 3,3-dimethylcyclohexan-1-amine;formamide |
|---|---|
| PubChem CID | 174943112 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 3,3-dimethylcyclohexan-1-amine;formamide |
| SMILES | CC1(C)CCCC(N)C1.NC=O |
| InChI | InChI=1S/C8H17N.CH3NO/c1-8(2)5-3-4-7(9)6-8;2-1-3/h7H,3-6,9H2,1-2H3;1H,(H2,2,3) |
| InChIKey | ZEGZILBAHZMCOZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|