About hexanediamide;1-methylcyclohexane-1,3-diamine
hexanediamide;1-methylcyclohexane-1,3-diamine (PubChem CID 118657914) has the molecular formula C13H28N4O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is hexanediamide;1-methylcyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | hexanediamide;1-methylcyclohexane-1,3-diamine |
| PubChem CID | 118657914 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | hexanediamide;1-methylcyclohexane-1,3-diamine |
| SMILES | CC1(N)CCCC(N)C1.NC(=O)CCCCC(N)=O |
| InChI | InChI=1S/C7H16N2.C6H12N2O2/c1-7(9)4-2-3-6(8)5-7;7-5(9)3-1-2-4-6(8)10/h6H,2-5,8-9H2,1H3;1-4H2,(H2,7,9)(H2,8,10) |
| InChIKey | ADOIZLBUMVCZKO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanediamide;1-methylcyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanediamide;1-methylcyclohexane-1,3-diamine?
The IUPAC name of hexanediamide;1-methylcyclohexane-1,3-diamine (CID 118657914) is hexanediamide;1-methylcyclohexane-1,3-diamine.
What is the SMILES notation for hexanediamide;1-methylcyclohexane-1,3-diamine?
The canonical SMILES for hexanediamide;1-methylcyclohexane-1,3-diamine is CC1(N)CCCC(N)C1.NC(=O)CCCCC(N)=O.
What is the InChIKey of hexanediamide;1-methylcyclohexane-1,3-diamine?
The InChIKey is ADOIZLBUMVCZKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.C6H12N2O2/c1-7(9)4-2-3-6(8)5-7;7-5(9)3-1-2-4-6(8)10/h6H,2-5,8-9H2,1H3;1-4H2,(H2,7,9)(H2,8,10).
What are the key properties of hexanediamide;1-methylcyclohexane-1,3-diamine?
hexanediamide;1-methylcyclohexane-1,3-diamine has a molecular weight of 272.39 g/mol, XLogP of 0.12, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexanediamide;1-methylcyclohexane-1,3-diamine is sourced from PubChem (CID 118657914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).