C13H28N4O2 — CID 118657914
hexanediamide;1-methylcyclohexane-1,3-diamine (PubChem CID 118657914) has the molecular formula C13H28N4O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is hexanediamide;1-methylcyclohexane-1,3-diamine.
| Compound Name | hexanediamide;1-methylcyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 118657914 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | hexanediamide;1-methylcyclohexane-1,3-diamine |
| SMILES | CC1(N)CCCC(N)C1.NC(=O)CCCCC(N)=O |
| InChI | InChI=1S/C7H16N2.C6H12N2O2/c1-7(9)4-2-3-6(8)5-7;7-5(9)3-1-2-4-6(8)10/h6H,2-5,8-9H2,1H3;1-4H2,(H2,7,9)(H2,8,10) |
| InChIKey | ADOIZLBUMVCZKO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|