C16H34N2O — CID 176680296
7-(3,3-dimethylpiperidin-1-yl)heptanamide;ethane (PubChem CID 176680296) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is 7-(3,3-dimethylpiperidin-1-yl)heptanamide;ethane.
| Compound Name | 7-(3,3-dimethylpiperidin-1-yl)heptanamide;ethane |
|---|---|
| PubChem CID | 176680296 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 7-(3,3-dimethylpiperidin-1-yl)heptanamide;ethane |
| SMILES | CC.CC1(C)CCCN(CCCCCCC(N)=O)C1 |
| InChI | InChI=1S/C14H28N2O.C2H6/c1-14(2)9-7-11-16(12-14)10-6-4-3-5-8-13(15)17;1-2/h3-12H2,1-2H3,(H2,15,17);1-2H3 |
| InChIKey | SXPQGUYAMXFRBJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|