C9H18FN — CID 131154120
1-(2-fluoroethyl)-3,3-dimethylpiperidine (PubChem CID 131154120) has the molecular formula C9H18FN and a molecular weight of 159.25 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3,3-dimethylpiperidine.
| Compound Name | 1-(2-fluoroethyl)-3,3-dimethylpiperidine |
|---|---|
| PubChem CID | 131154120 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 1-(2-fluoroethyl)-3,3-dimethylpiperidine |
| SMILES | CC1(C)CCCN(CCF)C1 |
| InChI | InChI=1S/C9H18FN/c1-9(2)4-3-6-11(8-9)7-5-10/h3-8H2,1-2H3 |
| InChIKey | RLGOOTCKKLDNLY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |