C10H22N2 — CID 103934688
(2R)-1-(3,3-dimethylpiperidin-1-yl)propan-2-amine (PubChem CID 103934688) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (2R)-1-(3,3-dimethylpiperidin-1-yl)propan-2-amine.
| Compound Name | (2R)-1-(3,3-dimethylpiperidin-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 103934688 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (2R)-1-(3,3-dimethylpiperidin-1-yl)propan-2-amine |
| SMILES | C[C@@H](N)CN1CCCC(C)(C)C1 |
| InChI | InChI=1S/C10H22N2/c1-9(11)7-12-6-4-5-10(2,3)8-12/h9H,4-8,11H2,1-3H3/t9-/m1/s1 |
| InChIKey | AHMHZUTXOWNCHB-SECBINFHSA-N |
| XLogP | 1.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |