C13H26N2 — CID 116680106
1-[2-(azetidin-3-yl)propyl]-3,3-dimethylpiperidine (PubChem CID 116680106) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-[2-(azetidin-3-yl)propyl]-3,3-dimethylpiperidine.
| Compound Name | 1-[2-(azetidin-3-yl)propyl]-3,3-dimethylpiperidine |
|---|---|
| PubChem CID | 116680106 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-[2-(azetidin-3-yl)propyl]-3,3-dimethylpiperidine |
| SMILES | CC(CN1CCCC(C)(C)C1)C1CNC1 |
| InChI | InChI=1S/C13H26N2/c1-11(12-7-14-8-12)9-15-6-4-5-13(2,3)10-15/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | DRRJXHDACCMDSW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |