C12H22O — CID 165024764
1-[(1S,3R)-3-propylcycloheptyl]ethanone (PubChem CID 165024764) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-[(1S,3R)-3-propylcycloheptyl]ethanone.
| Compound Name | 1-[(1S,3R)-3-propylcycloheptyl]ethanone |
|---|---|
| PubChem CID | 165024764 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 1-[(1S,3R)-3-propylcycloheptyl]ethanone |
| SMILES | CCC[C@@H]1CCCC[C@H](C(C)=O)C1 |
| InChI | InChI=1S/C12H22O/c1-3-6-11-7-4-5-8-12(9-11)10(2)13/h11-12H,3-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | SNMXMDILVREKKI-NEPJUHHUSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |