About cyclohexyl 3-cyclohexylbutanoate
cyclohexyl 3-cyclohexylbutanoate (PubChem CID 129263985) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is cyclohexyl 3-cyclohexylbutanoate.
Molecular Properties
| Compound Name | cyclohexyl 3-cyclohexylbutanoate |
| PubChem CID | 129263985 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | cyclohexyl 3-cyclohexylbutanoate |
| SMILES | CC(CC(=O)OC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H28O2/c1-13(14-8-4-2-5-9-14)12-16(17)18-15-10-6-3-7-11-15/h13-15H,2-12H2,1H3 |
| InChIKey | FWGMGMAFDKWLLP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl 3-cyclohexylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 3-cyclohexylbutanoate?
The IUPAC name of cyclohexyl 3-cyclohexylbutanoate (CID 129263985) is cyclohexyl 3-cyclohexylbutanoate.
What is the SMILES notation for cyclohexyl 3-cyclohexylbutanoate?
The canonical SMILES for cyclohexyl 3-cyclohexylbutanoate is CC(CC(=O)OC1CCCCC1)C1CCCCC1.
What is the InChIKey of cyclohexyl 3-cyclohexylbutanoate?
The InChIKey is FWGMGMAFDKWLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-13(14-8-4-2-5-9-14)12-16(17)18-15-10-6-3-7-11-15/h13-15H,2-12H2,1H3.
What are the key properties of cyclohexyl 3-cyclohexylbutanoate?
cyclohexyl 3-cyclohexylbutanoate has a molecular weight of 252.40 g/mol, XLogP of 4.47, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 3-cyclohexylbutanoate is sourced from PubChem (CID 129263985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).