About 3-cyclohexylbutanoate
3-cyclohexylbutanoate (PubChem CID 3992120) has the molecular formula C10H17O2-
and a molecular weight of 169.24 g/mol. Its IUPAC name is 3-cyclohexylbutanoate.
Molecular Properties
| Compound Name | 3-cyclohexylbutanoate |
| PubChem CID | 3992120 |
| Molecular Formula | C10H17O2- |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-cyclohexylbutanoate |
| SMILES | CC(CC(=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C10H18O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H,11,12)/p-1 |
| InChIKey | CDPQZLVBRUMMRQ-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylbutanoate?
The IUPAC name of 3-cyclohexylbutanoate (CID 3992120) is 3-cyclohexylbutanoate.
What is the SMILES notation for 3-cyclohexylbutanoate?
The canonical SMILES for 3-cyclohexylbutanoate is CC(CC(=O)[O-])C1CCCCC1.
What is the InChIKey of 3-cyclohexylbutanoate?
The InChIKey is CDPQZLVBRUMMRQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H,11,12)/p-1.
What are the key properties of 3-cyclohexylbutanoate?
3-cyclohexylbutanoate has a molecular weight of 169.24 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylbutanoate is sourced from PubChem (CID 3992120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).