About 1-cyclohexylethanethiol acetate
1-cyclohexylethanethiol acetate (PubChem CID 22215872) has the molecular formula C10H19O2S-
and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-cyclohexylethanethiol acetate.
Molecular Properties
| Compound Name | 1-cyclohexylethanethiol acetate |
| PubChem CID | 22215872 |
| Molecular Formula | C10H19O2S- |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-cyclohexylethanethiol acetate |
| SMILES | CC(=O)[O-].CC(S)C1CCCCC1 |
| InChI | InChI=1S/C8H16S.C2H4O2/c1-7(9)8-5-3-2-4-6-8;1-2(3)4/h7-9H,2-6H2,1H3;1H3,(H,3,4)/p-1 |
| InChIKey | BOXPABCMXIRDGM-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylethanethiol acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethanethiol acetate?
The IUPAC name of 1-cyclohexylethanethiol acetate (CID 22215872) is 1-cyclohexylethanethiol acetate.
What is the SMILES notation for 1-cyclohexylethanethiol acetate?
The canonical SMILES for 1-cyclohexylethanethiol acetate is CC(=O)[O-].CC(S)C1CCCCC1.
What is the InChIKey of 1-cyclohexylethanethiol acetate?
The InChIKey is BOXPABCMXIRDGM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16S.C2H4O2/c1-7(9)8-5-3-2-4-6-8;1-2(3)4/h7-9H,2-6H2,1H3;1H3,(H,3,4)/p-1.
What are the key properties of 1-cyclohexylethanethiol acetate?
1-cyclohexylethanethiol acetate has a molecular weight of 203.33 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethanethiol acetate is sourced from PubChem (CID 22215872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).