About tricyclopentylsulfanium acetate
tricyclopentylsulfanium acetate (PubChem CID 162329415) has the molecular formula C17H30O2S
and a molecular weight of 298.49 g/mol. Its IUPAC name is tricyclopentylsulfanium acetate.
Molecular Properties
| Compound Name | tricyclopentylsulfanium acetate |
| PubChem CID | 162329415 |
| Molecular Formula | C17H30O2S |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | tricyclopentylsulfanium acetate |
| SMILES | C1CCC([S+](C2CCCC2)C2CCCC2)C1.CC(=O)[O-] |
| InChI | InChI=1S/C15H27S.C2H4O2/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;1-2(3)4/h13-15H,1-12H2;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | GFVQKTLNGAYEPS-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze tricyclopentylsulfanium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclopentylsulfanium acetate?
The IUPAC name of tricyclopentylsulfanium acetate (CID 162329415) is tricyclopentylsulfanium acetate.
What is the SMILES notation for tricyclopentylsulfanium acetate?
The canonical SMILES for tricyclopentylsulfanium acetate is C1CCC([S+](C2CCCC2)C2CCCC2)C1.CC(=O)[O-].
What is the InChIKey of tricyclopentylsulfanium acetate?
The InChIKey is GFVQKTLNGAYEPS-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H27S.C2H4O2/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;1-2(3)4/h13-15H,1-12H2;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of tricyclopentylsulfanium acetate?
tricyclopentylsulfanium acetate has a molecular weight of 298.49 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclopentylsulfanium acetate is sourced from PubChem (CID 162329415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).