About 4-fluorobenzoate;tricyclopentylsulfanium
4-fluorobenzoate;tricyclopentylsulfanium (PubChem CID 159401377) has the molecular formula C22H31FO2S
and a molecular weight of 378.55 g/mol. Its IUPAC name is 4-fluorobenzoate;tricyclopentylsulfanium.
Molecular Properties
| Compound Name | 4-fluorobenzoate;tricyclopentylsulfanium |
| PubChem CID | 159401377 |
| Molecular Formula | C22H31FO2S |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 4-fluorobenzoate;tricyclopentylsulfanium |
| SMILES | C1CCC([S+](C2CCCC2)C2CCCC2)C1.O=C([O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C15H27S.C7H5FO2/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;8-6-3-1-5(2-4-6)7(9)10/h13-15H,1-12H2;1-4H,(H,9,10)/q+1;/p-1 |
| InChIKey | LNJOFEWOYKWYIO-UHFFFAOYSA-M |
| XLogP | 4.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobenzoate;tricyclopentylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzoate;tricyclopentylsulfanium?
The IUPAC name of 4-fluorobenzoate;tricyclopentylsulfanium (CID 159401377) is 4-fluorobenzoate;tricyclopentylsulfanium.
What is the SMILES notation for 4-fluorobenzoate;tricyclopentylsulfanium?
The canonical SMILES for 4-fluorobenzoate;tricyclopentylsulfanium is C1CCC([S+](C2CCCC2)C2CCCC2)C1.O=C([O-])c1ccc(F)cc1.
What is the InChIKey of 4-fluorobenzoate;tricyclopentylsulfanium?
The InChIKey is LNJOFEWOYKWYIO-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H27S.C7H5FO2/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;8-6-3-1-5(2-4-6)7(9)10/h13-15H,1-12H2;1-4H,(H,9,10)/q+1;/p-1.
What are the key properties of 4-fluorobenzoate;tricyclopentylsulfanium?
4-fluorobenzoate;tricyclopentylsulfanium has a molecular weight of 378.55 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzoate;tricyclopentylsulfanium is sourced from PubChem (CID 159401377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).