About copper bis(4-fluorobenzoate)
copper bis(4-fluorobenzoate) (PubChem CID 70452334) has the molecular formula C14H8CuF2O4
and a molecular weight of 341.76 g/mol. Its IUPAC name is copper bis(4-fluorobenzoate).
Molecular Properties
| Compound Name | copper bis(4-fluorobenzoate) |
| PubChem CID | 70452334 |
| Molecular Formula | C14H8CuF2O4 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | copper bis(4-fluorobenzoate) |
| SMILES | O=C([O-])c1ccc(F)cc1.O=C([O-])c1ccc(F)cc1.[Cu+2] |
| InChI | InChI=1S/2C7H5FO2.Cu/c2*8-6-3-1-5(2-4-6)7(9)10;/h2*1-4H,(H,9,10);/q;;+2/p-2 |
| InChIKey | CTNCZDHICITZGR-UHFFFAOYSA-L |
| XLogP | 0.38 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze copper bis(4-fluorobenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(4-fluorobenzoate)?
The IUPAC name of copper bis(4-fluorobenzoate) (CID 70452334) is copper bis(4-fluorobenzoate).
What is the SMILES notation for copper bis(4-fluorobenzoate)?
The canonical SMILES for copper bis(4-fluorobenzoate) is O=C([O-])c1ccc(F)cc1.O=C([O-])c1ccc(F)cc1.[Cu+2].
What is the InChIKey of copper bis(4-fluorobenzoate)?
The InChIKey is CTNCZDHICITZGR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H5FO2.Cu/c2*8-6-3-1-5(2-4-6)7(9)10;/h2*1-4H,(H,9,10);/q;;+2/p-2.
What are the key properties of copper bis(4-fluorobenzoate)?
copper bis(4-fluorobenzoate) has a molecular weight of 341.76 g/mol, XLogP of 0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(4-fluorobenzoate) is sourced from PubChem (CID 70452334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).