C14H14FO3- — CID 11921386
trans-(1R,2R)-2-(4-fluorobenzoyl)cyclohexane-1-carboxylate (PubChem CID 11921386) has the molecular formula C14H14FO3- and a molecular weight of 249.26 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-fluorobenzoyl)cyclohexane-1-carboxylate.
| Compound Name | trans-(1R,2R)-2-(4-fluorobenzoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11921386 |
| Molecular Formula | C14H14FO3- |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | trans-(1R,2R)-2-(4-fluorobenzoyl)cyclohexane-1-carboxylate |
| SMILES | O=C([O-])[C@@H]1CCCC[C@H]1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FO3/c15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h5-8,11-12H,1-4H2,(H,17,18)/p-1/t11-,12-/m1/s1 |
| InChIKey | RCCIJJKDNJBQIL-VXGBXAGGSA-M |
| XLogP | 1.56 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |