C15H15F3O3 — CID 69189577
2-[4-(trifluoromethyl)benzoyl]cyclohexane-1-carboxylic acid (PubChem CID 69189577) has the molecular formula C15H15F3O3 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)benzoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[4-(trifluoromethyl)benzoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 69189577 |
| Molecular Formula | C15H15F3O3 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-[4-(trifluoromethyl)benzoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3O3/c16-15(17,18)10-7-5-9(6-8-10)13(19)11-3-1-2-4-12(11)14(20)21/h5-8,11-12H,1-4H2,(H,20,21) |
| InChIKey | VWBZXRKFNOBABC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |