C14H13F3O3 — CID 146004587
2-(3,4,5-trifluorobenzoyl)cyclohexane-1-carboxylic acid (PubChem CID 146004587) has the molecular formula C14H13F3O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-(3,4,5-trifluorobenzoyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-(3,4,5-trifluorobenzoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 146004587 |
| Molecular Formula | C14H13F3O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-(3,4,5-trifluorobenzoyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H13F3O3/c15-10-5-7(6-11(16)12(10)17)13(18)8-3-1-2-4-9(8)14(19)20/h5-6,8-9H,1-4H2,(H,19,20) |
| InChIKey | DDQAOBDDEQSPAU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|