C15H14F3N3O2 — CID 167982675
cis-(1R,2S)-2-[4-(3,4,5-trifluorophenyl)triazol-1-yl]cyclohexane-1-carboxylic acid (PubChem CID 167982675) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is cis-(1R,2S)-2-[4-(3,4,5-trifluorophenyl)triazol-1-yl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[4-(3,4,5-trifluorophenyl)triazol-1-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 167982675 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | cis-(1R,2S)-2-[4-(3,4,5-trifluorophenyl)triazol-1-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCC[C@@H]1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C15H14F3N3O2/c16-10-5-8(6-11(17)14(10)18)12-7-21(20-19-12)13-4-2-1-3-9(13)15(22)23/h5-7,9,13H,1-4H2,(H,22,23)/t9-,13+/m1/s1 |
| InChIKey | SWPBWXJWDTVNFF-RNCFNFMXSA-N |
| XLogP | 3.18 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|