C19H20F3N3O7 — CID 166457279
2-[[(5S,7R,8R,9S,10R)-8-hydroxy-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-10-yl]oxy]acetic acid (PubChem CID 166457279) has the molecular formula C19H20F3N3O7 and a molecular weight of 459.38 g/mol. Its IUPAC name is 2-[[(5S,7R,8R,9S,10R)-8-hydroxy-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-10-yl]oxy]acetic acid.
| Compound Name | 2-[[(5S,7R,8R,9S,10R)-8-hydroxy-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-10-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 166457279 |
| Molecular Formula | C19H20F3N3O7 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 2-[[(5S,7R,8R,9S,10R)-8-hydroxy-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-10-yl]oxy]acetic acid |
| SMILES | O=C(O)CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@]12CCCO2 |
| InChI | InChI=1S/C19H20F3N3O7/c20-10-4-9(5-11(21)15(10)22)12-6-25(24-23-12)16-17(29)13(7-26)32-19(2-1-3-31-19)18(16)30-8-14(27)28/h4-6,13,16-18,26,29H,1-3,7-8H2,(H,27,28)/t13-,16+,17+,18-,19+/m1/s1 |
| InChIKey | CWEIOMSXFMXCNV-DTBDJWGBSA-N |
| XLogP | 0.63 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|