C25H25F3N4O6 — CID 174231518
2-[[(5R,7R,8R,9R,10R)-8-hydroxy-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-10-yl]oxy]-N-phenylacetamide (PubChem CID 174231518) has the molecular formula C25H25F3N4O6 and a molecular weight of 534.49 g/mol. Its IUPAC name is 2-[[(5R,7R,8R,9R,10R)-8-hydroxy-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-10-yl]oxy]-N-phenylacetamide.
| Compound Name | 2-[[(5R,7R,8R,9R,10R)-8-hydroxy-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-10-yl]oxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 174231518 |
| Molecular Formula | C25H25F3N4O6 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 2-[[(5R,7R,8R,9R,10R)-8-hydroxy-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-10-yl]oxy]-N-phenylacetamide |
| SMILES | O=C(CO[C@@H]1[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@]12CCCO2)Nc1ccccc1 |
| InChI | InChI=1S/C25H25F3N4O6/c26-16-9-14(10-17(27)21(16)28)18-11-32(31-30-18)22-23(35)19(12-33)38-25(7-4-8-37-25)24(22)36-13-20(34)29-15-5-2-1-3-6-15/h1-3,5-6,9-11,19,22-24,33,35H,4,7-8,12-13H2,(H,29,34)/t19-,22-,23+,24-,25-/m1/s1 |
| InChIKey | IRYXFWVJKVFXJO-HYOIWIKGSA-N |
| XLogP | 2.19 |
| TPSA | 127.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|