C29H27F3N4O5 — CID 166457239
[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecan-8-yl]-naphthalen-2-ylmethanone (PubChem CID 166457239) has the molecular formula C29H27F3N4O5 and a molecular weight of 568.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecan-8-yl]-naphthalen-2-ylmethanone.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecan-8-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 166457239 |
| Molecular Formula | C29H27F3N4O5 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecan-8-yl]-naphthalen-2-ylmethanone |
| SMILES | O=C(c1ccc2ccccc2c1)N1CCC[C@]2(C1)O[C@H](CO)[C@H](O)[C@H](n1cc(-c3cc(F)c(F)c(F)c3)nn1)[C@H]2O |
| InChI | InChI=1S/C29H27F3N4O5/c30-20-11-19(12-21(31)24(20)32)22-13-36(34-33-22)25-26(38)23(14-37)41-29(27(25)39)8-3-9-35(15-29)28(40)18-7-6-16-4-1-2-5-17(16)10-18/h1-2,4-7,10-13,23,25-27,37-39H,3,8-9,14-15H2/t23-,25+,26+,27-,29-/m1/s1 |
| InChIKey | MSJNGRNFGOLJHZ-UIGAIOKKSA-N |
| XLogP | 2.84 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|