C25H25F4N3O5 — CID 166457333
(2R,3R,4S,5R,6S)-5-[(3-fluorophenyl)methoxy]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-3-ol (PubChem CID 166457333) has the molecular formula C25H25F4N3O5 and a molecular weight of 523.48 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-5-[(3-fluorophenyl)methoxy]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-5-[(3-fluorophenyl)methoxy]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-3-ol |
|---|---|
| PubChem CID | 166457333 |
| Molecular Formula | C25H25F4N3O5 |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (2R,3R,4S,5R,6S)-5-[(3-fluorophenyl)methoxy]-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-3-ol |
| SMILES | OC[C@H]1O[C@@]2(CCCCO2)[C@H](OCc2cccc(F)c2)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C25H25F4N3O5/c26-16-5-3-4-14(8-16)13-35-24-22(23(34)20(12-33)37-25(24)6-1-2-7-36-25)32-11-19(30-31-32)15-9-17(27)21(29)18(28)10-15/h3-5,8-11,20,22-24,33-34H,1-2,6-7,12-13H2/t20-,22+,23+,24-,25+/m1/s1 |
| InChIKey | TWKHQJPGOCNJJQ-MASZLTEFSA-N |
| XLogP | 3.28 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|