C25H23F6N3O5 — CID 166457341
(5S,7R,8R,9S,10R)-7-(hydroxymethyl)-10-[[3-(trifluoromethyl)phenyl]methoxy]-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol (PubChem CID 166457341) has the molecular formula C25H23F6N3O5 and a molecular weight of 559.46 g/mol. Its IUPAC name is (5S,7R,8R,9S,10R)-7-(hydroxymethyl)-10-[[3-(trifluoromethyl)phenyl]methoxy]-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol.
| Compound Name | (5S,7R,8R,9S,10R)-7-(hydroxymethyl)-10-[[3-(trifluoromethyl)phenyl]methoxy]-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 166457341 |
| Molecular Formula | C25H23F6N3O5 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | (5S,7R,8R,9S,10R)-7-(hydroxymethyl)-10-[[3-(trifluoromethyl)phenyl]methoxy]-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol |
| SMILES | OC[C@H]1O[C@@]2(CCCO2)[C@H](OCc2cccc(C(F)(F)F)c2)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C25H23F6N3O5/c26-16-8-14(9-17(27)20(16)28)18-10-34(33-32-18)21-22(36)19(11-35)39-24(5-2-6-38-24)23(21)37-12-13-3-1-4-15(7-13)25(29,30)31/h1,3-4,7-10,19,21-23,35-36H,2,5-6,11-12H2/t19-,21+,22+,23-,24+/m1/s1 |
| InChIKey | FFRZBEVITWBAKY-SKFMWMRISA-N |
| XLogP | 3.77 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|