C26H26F3N3O7 — CID 174231554
[(2R,3R,4R,5R,6R)-3-hydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-5-yl] 3-methoxybenzoate (PubChem CID 174231554) has the molecular formula C26H26F3N3O7 and a molecular weight of 549.50 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3-hydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-5-yl] 3-methoxybenzoate.
| Compound Name | [(2R,3R,4R,5R,6R)-3-hydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-5-yl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 174231554 |
| Molecular Formula | C26H26F3N3O7 |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3-hydroxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-5-yl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)O[C@@H]2[C@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)[C@@H](O)[C@@H](CO)O[C@]23CCCCO3)c1 |
| InChI | InChI=1S/C26H26F3N3O7/c1-36-16-6-4-5-14(9-16)25(35)38-24-22(23(34)20(13-33)39-26(24)7-2-3-8-37-26)32-12-19(30-31-32)15-10-17(27)21(29)18(28)11-15/h4-6,9-12,20,22-24,33-34H,2-3,7-8,13H2,1H3/t20-,22-,23+,24-,26-/m1/s1 |
| InChIKey | NJOJOOHMKHVJNS-DNMDETFRSA-N |
| XLogP | 2.79 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|