C19H22F3N3O4 — CID 167286005
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-5-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-3-ol (PubChem CID 167286005) has the molecular formula C19H22F3N3O4 and a molecular weight of 413.40 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-5-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-3-ol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-5-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-3-ol |
|---|---|
| PubChem CID | 167286005 |
| Molecular Formula | C19H22F3N3O4 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-5-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,7-dioxaspiro[5.5]undecan-3-ol |
| SMILES | CC1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@]12CCCCO2 |
| InChI | InChI=1S/C19H22F3N3O4/c1-10-17(18(27)15(9-26)29-19(10)4-2-3-5-28-19)25-8-14(23-24-25)11-6-12(20)16(22)13(21)7-11/h6-8,10,15,17-18,26-27H,2-5,9H2,1H3/t10?,15-,17-,18+,19+/m1/s1 |
| InChIKey | QUXBHGAKAPSRPW-DVAQCNFVSA-N |
| XLogP | 2.19 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|