C24H24ClF3N4O4 — CID 171472111
(2R,3R,4S,6R)-8-(3-chlorophenyl)-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecane-3,5-diol (PubChem CID 171472111) has the molecular formula C24H24ClF3N4O4 and a molecular weight of 524.93 g/mol. Its IUPAC name is (2R,3R,4S,6R)-8-(3-chlorophenyl)-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecane-3,5-diol.
| Compound Name | (2R,3R,4S,6R)-8-(3-chlorophenyl)-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecane-3,5-diol |
|---|---|
| PubChem CID | 171472111 |
| Molecular Formula | C24H24ClF3N4O4 |
| Molecular Weight | 524.93 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | (2R,3R,4S,6R)-8-(3-chlorophenyl)-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1-oxa-8-azaspiro[5.5]undecane-3,5-diol |
| SMILES | OC[C@H]1O[C@@]2(CCCN(c3cccc(Cl)c3)C2)C(O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C24H24ClF3N4O4/c25-14-3-1-4-15(9-14)31-6-2-5-24(12-31)23(35)21(22(34)19(11-33)36-24)32-10-18(29-30-32)13-7-16(26)20(28)17(27)8-13/h1,3-4,7-10,19,21-23,33-35H,2,5-6,11-12H2/t19-,21+,22+,23?,24-/m1/s1 |
| InChIKey | YOKSFFMFIVYNMJ-JXYRFVNGSA-N |
| XLogP | 2.71 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.93 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|