C20H16Cl2F3N3O5S — CID 122443542
(2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfinyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 122443542) has the molecular formula C20H16Cl2F3N3O5S and a molecular weight of 538.33 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfinyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfinyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 122443542 |
| Molecular Formula | C20H16Cl2F3N3O5S |
| Molecular Weight | 538.33 g/mol |
| Exact Mass | 537.01 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfinyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | O=S(c1ccc(Cl)c(Cl)c1)[C@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C20H16Cl2F3N3O5S/c21-10-2-1-9(5-11(10)22)34(32)20-19(31)17(18(30)15(7-29)33-20)28-6-14(26-27-28)8-3-12(23)16(25)13(24)4-8/h1-6,15,17-20,29-31H,7H2/t15-,17+,18+,19-,20-,34?/m1/s1 |
| InChIKey | UOMXVCAZLNHYES-GJLRFVAKSA-N |
| XLogP | 2.46 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|