C21H18Cl2F3N3O5S — CID 138544316
(2R,3R,4S,5R,6R)-6-(3,4-dichlorophenyl)sulfinyl-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 138544316) has the molecular formula C21H18Cl2F3N3O5S and a molecular weight of 552.36 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(3,4-dichlorophenyl)sulfinyl-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-6-(3,4-dichlorophenyl)sulfinyl-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 138544316 |
| Molecular Formula | C21H18Cl2F3N3O5S |
| Molecular Weight | 552.36 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(3,4-dichlorophenyl)sulfinyl-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1S(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl2F3N3O5S/c1-33-20-18(29-7-15(27-28-29)9-4-13(24)17(26)14(25)5-9)19(31)16(8-30)34-21(20)35(32)10-2-3-11(22)12(23)6-10/h2-7,16,18-21,30-31H,8H2,1H3/t16-,18+,19+,20-,21-,35?/m1/s1 |
| InChIKey | HIKCMRNFOOJABB-VXJDILCZSA-N |
| XLogP | 3.11 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|