C23H25F3N4O6 — CID 170691975
(2R,3R,4S,5R,6R)-6-[[5-(1-hydroxycyclobutyl)-1,2-oxazol-3-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 170691975) has the molecular formula C23H25F3N4O6 and a molecular weight of 510.47 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-[[5-(1-hydroxycyclobutyl)-1,2-oxazol-3-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-6-[[5-(1-hydroxycyclobutyl)-1,2-oxazol-3-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 170691975 |
| Molecular Formula | C23H25F3N4O6 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-[[5-(1-hydroxycyclobutyl)-1,2-oxazol-3-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cc(C2(O)CCC2)on1 |
| InChI | InChI=1S/C23H25F3N4O6/c1-34-22-16(7-12-8-18(36-28-12)23(33)3-2-4-23)35-17(10-31)21(32)20(22)30-9-15(27-29-30)11-5-13(24)19(26)14(25)6-11/h5-6,8-9,16-17,20-22,31-33H,2-4,7,10H2,1H3/t16-,17-,20+,21+,22+/m1/s1 |
| InChIKey | NJEZRFKUGJXTHR-MLMGXCOMSA-N |
| XLogP | 1.64 |
| TPSA | 135.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|