C29H38F3N5O7 — CID 163238449
tert-butyl N-[3-[[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl]-1-oxa-2-azaspiro[4.5]dec-2-en-8-yl]carbamate (PubChem CID 163238449) has the molecular formula C29H38F3N5O7 and a molecular weight of 625.65 g/mol. Its IUPAC name is tert-butyl N-[3-[[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl]-1-oxa-2-azaspiro[4.5]dec-2-en-8-yl]carbamate.
| Compound Name | tert-butyl N-[3-[[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl]-1-oxa-2-azaspiro[4.5]dec-2-en-8-yl]carbamate |
|---|---|
| PubChem CID | 163238449 |
| Molecular Formula | C29H38F3N5O7 |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | tert-butyl N-[3-[[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl]-1-oxa-2-azaspiro[4.5]dec-2-en-8-yl]carbamate |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1CC1=NOC2(CCC(NC(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C29H38F3N5O7/c1-28(2,3)43-27(40)33-16-5-7-29(8-6-16)12-17(35-44-29)11-21-26(41-4)24(25(39)22(14-38)42-21)37-13-20(34-36-37)15-9-18(30)23(32)19(31)10-15/h9-10,13,16,21-22,24-26,38-39H,5-8,11-12,14H2,1-4H3,(H,33,40)/t16?,21-,22-,24+,25+,26+,29?/m1/s1 |
| InChIKey | FLFDIYVEYVQXCC-YOWBRYPUSA-N |
| XLogP | 3.41 |
| TPSA | 149.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|