C25H30F3N5O5 — CID 164943023
(2R,3R,4S,5R,6R)-6-[[3-(4-aminocyclohexyl)-1,2-oxazol-5-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 164943023) has the molecular formula C25H30F3N5O5 and a molecular weight of 537.54 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-[[3-(4-aminocyclohexyl)-1,2-oxazol-5-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-6-[[3-(4-aminocyclohexyl)-1,2-oxazol-5-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 164943023 |
| Molecular Formula | C25H30F3N5O5 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-[[3-(4-aminocyclohexyl)-1,2-oxazol-5-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cc(C2CCC(N)CC2)no1 |
| InChI | InChI=1S/C25H30F3N5O5/c1-36-25-20(9-15-8-18(31-38-15)12-2-4-14(29)5-3-12)37-21(11-34)24(35)23(25)33-10-19(30-32-33)13-6-16(26)22(28)17(27)7-13/h6-8,10,12,14,20-21,23-25,34-35H,2-5,9,11,29H2,1H3/t12?,14?,20-,21-,23+,24+,25+/m1/s1 |
| InChIKey | OMFAOTOZBNGHAB-BSEUHMDMSA-N |
| XLogP | 2.25 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|