C25H29F2N5O7 — CID 164519011
4-[5-[[(2R,3R,4S,5R,6R)-4-[4-(3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]methyl]-1,2-oxazol-3-yl]piperidine-1-carboxylic acid (PubChem CID 164519011) has the molecular formula C25H29F2N5O7 and a molecular weight of 549.53 g/mol. Its IUPAC name is 4-[5-[[(2R,3R,4S,5R,6R)-4-[4-(3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]methyl]-1,2-oxazol-3-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[5-[[(2R,3R,4S,5R,6R)-4-[4-(3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]methyl]-1,2-oxazol-3-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 164519011 |
| Molecular Formula | C25H29F2N5O7 |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 4-[5-[[(2R,3R,4S,5R,6R)-4-[4-(3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]methyl]-1,2-oxazol-3-yl]piperidine-1-carboxylic acid |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)cc(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cc(C2CCN(C(=O)O)CC2)no1 |
| InChI | InChI=1S/C25H29F2N5O7/c1-37-24-20(10-17-9-18(29-39-17)13-2-4-31(5-3-13)25(35)36)38-21(12-33)23(34)22(24)32-11-19(28-30-32)14-6-15(26)8-16(27)7-14/h6-9,11,13,20-24,33-34H,2-5,10,12H2,1H3,(H,35,36)/t20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | VOQUFLOTTRDDAO-DJCPXJLLSA-N |
| XLogP | 1.99 |
| TPSA | 156.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |