C26H30F3N5O7 — CID 156643636
ethyl 4-[3-[[(2R,3R,4R,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl]-1,2-oxazol-5-yl]piperidine-1-carboxylate (PubChem CID 156643636) has the molecular formula C26H30F3N5O7 and a molecular weight of 581.55 g/mol. Its IUPAC name is ethyl 4-[3-[[(2R,3R,4R,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl]-1,2-oxazol-5-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-[[(2R,3R,4R,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl]-1,2-oxazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156643636 |
| Molecular Formula | C26H30F3N5O7 |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | ethyl 4-[3-[[(2R,3R,4R,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl]-1,2-oxazol-5-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(c2cc(C[C@H]3O[C@H](CO)[C@H](O)[C@H](n4cc(-c5cc(F)c(F)c(F)c5)nn4)[C@H]3O)no2)CC1 |
| InChI | InChI=1S/C26H30F3N5O7/c1-2-39-26(38)33-5-3-13(4-6-33)19-9-15(31-41-19)10-20-24(36)23(25(37)21(12-35)40-20)34-11-18(30-32-34)14-7-16(27)22(29)17(28)8-14/h7-9,11,13,20-21,23-25,35-37H,2-6,10,12H2,1H3/t20-,21-,23-,24+,25+/m1/s1 |
| InChIKey | ZOAXOEWRKDJKFE-XUSKWMGMSA-N |
| XLogP | 1.95 |
| TPSA | 156.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|