C24H27F3N4O5 — CID 172721035
(2R,3R,4R,5R,6R)-2-[(5-cyclohexyl-1,2-oxazol-3-yl)methyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 172721035) has the molecular formula C24H27F3N4O5 and a molecular weight of 508.50 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-[(5-cyclohexyl-1,2-oxazol-3-yl)methyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-[(5-cyclohexyl-1,2-oxazol-3-yl)methyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 172721035 |
| Molecular Formula | C24H27F3N4O5 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-[(5-cyclohexyl-1,2-oxazol-3-yl)methyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@H](Cc2cc(C3CCCCC3)on2)[C@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C24H27F3N4O5/c25-15-6-13(7-16(26)21(15)27)17-10-31(30-28-17)22-23(33)19(35-20(11-32)24(22)34)9-14-8-18(36-29-14)12-4-2-1-3-5-12/h6-8,10,12,19-20,22-24,32-34H,1-5,9,11H2/t19-,20-,22-,23+,24+/m1/s1 |
| InChIKey | GNAPTCPBFYHVRQ-VEEZHQPXSA-N |
| XLogP | 2.66 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|