C24H28F2N4O5 — CID 156643716
(2R,3R,4S,5R,6R)-6-[(5-cyclobutyl-1,2-oxazol-3-yl)methyl]-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol (PubChem CID 156643716) has the molecular formula C24H28F2N4O5 and a molecular weight of 490.51 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-[(5-cyclobutyl-1,2-oxazol-3-yl)methyl]-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-6-[(5-cyclobutyl-1,2-oxazol-3-yl)methyl]-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 156643716 |
| Molecular Formula | C24H28F2N4O5 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-[(5-cyclobutyl-1,2-oxazol-3-yl)methyl]-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(C)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cc(C2CCC2)on1 |
| InChI | InChI=1S/C24H28F2N4O5/c1-12-6-7-15(21(26)20(12)25)16-10-30(29-27-16)22-23(32)19(11-31)34-18(24(22)33-2)9-14-8-17(35-28-14)13-4-3-5-13/h6-8,10,13,18-19,22-24,31-32H,3-5,9,11H2,1-2H3/t18-,19-,22+,23+,24+/m1/s1 |
| InChIKey | NQZJJWXYKUYIOH-PGEXYDAJSA-N |
| XLogP | 2.71 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |