C23H25F5N6O5 — CID 164914067
(2R,3R,4S,5R,6R)-6-[[1-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(2,3,4-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 164914067) has the molecular formula C23H25F5N6O5 and a molecular weight of 560.48 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-[[1-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(2,3,4-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-6-[[1-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(2,3,4-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 164914067 |
| Molecular Formula | C23H25F5N6O5 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-[[1-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(2,3,4-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(F)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cn(C2(CO)CC(F)(F)C2)nn1 |
| InChI | InChI=1S/C23H25F5N6O5/c1-38-21-15(4-11-5-34(32-29-11)22(10-36)8-23(27,28)9-22)39-16(7-35)20(37)19(21)33-6-14(30-31-33)12-2-3-13(24)18(26)17(12)25/h2-3,5-6,15-16,19-21,35-37H,4,7-10H2,1H3/t15-,16-,19+,20+,21+/m1/s1 |
| InChIKey | YJJOGKVHXJXDAF-QANQIFJLSA-N |
| XLogP | 0.99 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|