C24H27BrF2N6O5 — CID 169227645
(2R,3R,4S,5R,6R)-4-[4-(4-bromo-2,3-difluorophenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-[[1-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)triazol-4-yl]methyl]oxan-3-ol (PubChem CID 169227645) has the molecular formula C24H27BrF2N6O5 and a molecular weight of 597.42 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(4-bromo-2,3-difluorophenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-[[1-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)triazol-4-yl]methyl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(4-bromo-2,3-difluorophenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-[[1-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)triazol-4-yl]methyl]oxan-3-ol |
|---|---|
| PubChem CID | 169227645 |
| Molecular Formula | C24H27BrF2N6O5 |
| Molecular Weight | 597.42 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(4-bromo-2,3-difluorophenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-[[1-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)triazol-4-yl]methyl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(Br)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cn(C23COC(C)(C2)C3)nn1 |
| InChI | InChI=1S/C24H27BrF2N6O5/c1-23-9-24(10-23,11-37-23)33-6-12(28-31-33)5-16-22(36-2)20(21(35)17(8-34)38-16)32-7-15(29-30-32)13-3-4-14(25)19(27)18(13)26/h3-4,6-7,16-17,20-22,34-35H,5,8-11H2,1-2H3/t16-,17-,20+,21+,22+,23?,24?/m1/s1 |
| InChIKey | REWCPBWVGAAPKY-JLAZJDPYSA-N |
| XLogP | 1.77 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|