C23H27F3N6O6 — CID 169227613
(2R,3R,4S,5R,6R)-6-[[1-[3-(2-hydroxyethyl)oxetan-3-yl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(2,3,4-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 169227613) has the molecular formula C23H27F3N6O6 and a molecular weight of 540.50 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-[[1-[3-(2-hydroxyethyl)oxetan-3-yl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(2,3,4-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-6-[[1-[3-(2-hydroxyethyl)oxetan-3-yl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(2,3,4-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 169227613 |
| Molecular Formula | C23H27F3N6O6 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-[[1-[3-(2-hydroxyethyl)oxetan-3-yl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(2,3,4-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(F)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cn(C2(CCO)COC2)nn1 |
| InChI | InChI=1S/C23H27F3N6O6/c1-36-22-16(6-12-7-32(30-27-12)23(4-5-33)10-37-11-23)38-17(9-34)21(35)20(22)31-8-15(28-29-31)13-2-3-14(24)19(26)18(13)25/h2-3,7-8,16-17,20-22,33-35H,4-6,9-11H2,1H3/t16-,17-,20+,21+,22+/m1/s1 |
| InChIKey | ZRAMBERLZRGVNN-MLMGXCOMSA-N |
| XLogP | -0.02 |
| TPSA | 149.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|