C22H24BrF3N6O5 — CID 164913916
(2R,3R,4S,5R,6R)-4-[4-(4-bromo-2,3-difluorophenyl)triazol-1-yl]-6-[[1-[3-(fluoromethyl)oxetan-3-yl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol (PubChem CID 164913916) has the molecular formula C22H24BrF3N6O5 and a molecular weight of 589.37 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(4-bromo-2,3-difluorophenyl)triazol-1-yl]-6-[[1-[3-(fluoromethyl)oxetan-3-yl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(4-bromo-2,3-difluorophenyl)triazol-1-yl]-6-[[1-[3-(fluoromethyl)oxetan-3-yl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 164913916 |
| Molecular Formula | C22H24BrF3N6O5 |
| Molecular Weight | 589.37 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(4-bromo-2,3-difluorophenyl)triazol-1-yl]-6-[[1-[3-(fluoromethyl)oxetan-3-yl]triazol-4-yl]methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(Br)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cn(C2(CF)COC2)nn1 |
| InChI | InChI=1S/C22H24BrF3N6O5/c1-35-21-15(4-11-5-32(30-27-11)22(8-24)9-36-10-22)37-16(7-33)20(34)19(21)31-6-14(28-29-31)12-2-3-13(23)18(26)17(12)25/h2-3,5-6,15-16,19-21,33-34H,4,7-10H2,1H3/t15-,16-,19+,20+,21+/m1/s1 |
| InChIKey | RMEFSEODMMDMRE-QANQIFJLSA-N |
| XLogP | 1.19 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|