C23H26F3N5O5 — CID 175743319
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[5-[(3R)-pyrrolidin-3-yl]-1,2-oxazol-3-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 175743319) has the molecular formula C23H26F3N5O5 and a molecular weight of 509.49 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[5-[(3R)-pyrrolidin-3-yl]-1,2-oxazol-3-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[5-[(3R)-pyrrolidin-3-yl]-1,2-oxazol-3-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 175743319 |
| Molecular Formula | C23H26F3N5O5 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-5-methoxy-6-[[5-[(3R)-pyrrolidin-3-yl]-1,2-oxazol-3-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Cc1cc([C@@H]2CCNC2)on1 |
| InChI | InChI=1S/C23H26F3N5O5/c1-34-23-18(7-13-6-17(36-29-13)11-2-3-27-8-11)35-19(10-32)22(33)21(23)31-9-16(28-30-31)12-4-14(24)20(26)15(25)5-12/h4-6,9,11,18-19,21-23,27,32-33H,2-3,7-8,10H2,1H3/t11-,18-,19-,21+,22+,23+/m1/s1 |
| InChIKey | UDDPVMGKSIIEAO-GESIMRHLSA-N |
| XLogP | 1.35 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|